About 3-(1,2-diaminoethyl)-1H-pyrrole-2-carbaldehyde;manganese;1H-pyrrole-2-carbaldehyde
3-(1,2-diaminoethyl)-1H-pyrrole-2-carbaldehyde;manganese;1H-pyrrole-2-carbaldehyde (PubChem CID 87429709) has the molecular formula C12H16MnN4O2
and a molecular weight of 303.22 g/mol. Its IUPAC name is 3-(1,2-diaminoethyl)-1H-pyrrole-2-carbaldehyde;manganese;1H-pyrrole-2-carbaldehyde.
Molecular Properties
| Compound Name | 3-(1,2-diaminoethyl)-1H-pyrrole-2-carbaldehyde;manganese;1H-pyrrole-2-carbaldehyde |
| PubChem CID | 87429709 |
| Molecular Formula | C12H16MnN4O2 |
| Molecular Weight | 303.22 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 3-(1,2-diaminoethyl)-1H-pyrrole-2-carbaldehyde;manganese;1H-pyrrole-2-carbaldehyde |
| SMILES | NCC(N)c1cc[nH]c1C=O.O=Cc1ccc[nH]1.[Mn] |
| InChI | InChI=1S/C7H11N3O.C5H5NO.Mn/c8-3-6(9)5-1-2-10-7(5)4-11;7-4-5-2-1-3-6-5;/h1-2,4,6,10H,3,8-9H2;1-4,6H; |
| InChIKey | OCTQAAODAXJOTF-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 117.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.22 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,2-diaminoethyl)-1H-pyrrole-2-carbaldehyde;manganese;1H-pyrrole-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2-diaminoethyl)-1H-pyrrole-2-carbaldehyde;manganese;1H-pyrrole-2-carbaldehyde?
The IUPAC name of 3-(1,2-diaminoethyl)-1H-pyrrole-2-carbaldehyde;manganese;1H-pyrrole-2-carbaldehyde (CID 87429709) is 3-(1,2-diaminoethyl)-1H-pyrrole-2-carbaldehyde;manganese;1H-pyrrole-2-carbaldehyde.
What is the SMILES notation for 3-(1,2-diaminoethyl)-1H-pyrrole-2-carbaldehyde;manganese;1H-pyrrole-2-carbaldehyde?
The canonical SMILES for 3-(1,2-diaminoethyl)-1H-pyrrole-2-carbaldehyde;manganese;1H-pyrrole-2-carbaldehyde is NCC(N)c1cc[nH]c1C=O.O=Cc1ccc[nH]1.[Mn].
What is the InChIKey of 3-(1,2-diaminoethyl)-1H-pyrrole-2-carbaldehyde;manganese;1H-pyrrole-2-carbaldehyde?
The InChIKey is OCTQAAODAXJOTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O.C5H5NO.Mn/c8-3-6(9)5-1-2-10-7(5)4-11;7-4-5-2-1-3-6-5;/h1-2,4,6,10H,3,8-9H2;1-4,6H;.
What are the key properties of 3-(1,2-diaminoethyl)-1H-pyrrole-2-carbaldehyde;manganese;1H-pyrrole-2-carbaldehyde?
3-(1,2-diaminoethyl)-1H-pyrrole-2-carbaldehyde;manganese;1H-pyrrole-2-carbaldehyde has a molecular weight of 303.22 g/mol, XLogP of 0.61, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2-diaminoethyl)-1H-pyrrole-2-carbaldehyde;manganese;1H-pyrrole-2-carbaldehyde is sourced from PubChem (CID 87429709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).