C12H16MnN4O2 — CID 87429709
3-(1,2-diaminoethyl)-1H-pyrrole-2-carbaldehyde;manganese;1H-pyrrole-2-carbaldehyde (PubChem CID 87429709) has the molecular formula C12H16MnN4O2 and a molecular weight of 303.22 g/mol. Its IUPAC name is 3-(1,2-diaminoethyl)-1H-pyrrole-2-carbaldehyde;manganese;1H-pyrrole-2-carbaldehyde.
| Compound Name | 3-(1,2-diaminoethyl)-1H-pyrrole-2-carbaldehyde;manganese;1H-pyrrole-2-carbaldehyde |
|---|---|
| PubChem CID | 87429709 |
| Molecular Formula | C12H16MnN4O2 |
| Molecular Weight | 303.22 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 3-(1,2-diaminoethyl)-1H-pyrrole-2-carbaldehyde;manganese;1H-pyrrole-2-carbaldehyde |
| SMILES | NCC(N)c1cc[nH]c1C=O.O=Cc1ccc[nH]1.[Mn] |
| InChI | InChI=1S/C7H11N3O.C5H5NO.Mn/c8-3-6(9)5-1-2-10-7(5)4-11;7-4-5-2-1-3-6-5;/h1-2,4,6,10H,3,8-9H2;1-4,6H; |
| InChIKey | OCTQAAODAXJOTF-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 117.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.22 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|