C12H16N4O — CID 175241696
1H-pyrrole-2-carbaldehyde;2-(1H-pyrrol-2-ylmethylideneamino)ethanamine (PubChem CID 175241696) has the molecular formula C12H16N4O and a molecular weight of 232.29 g/mol. Its IUPAC name is 1H-pyrrole-2-carbaldehyde;2-(1H-pyrrol-2-ylmethylideneamino)ethanamine.
| Compound Name | 1H-pyrrole-2-carbaldehyde;2-(1H-pyrrol-2-ylmethylideneamino)ethanamine |
|---|---|
| PubChem CID | 175241696 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 1H-pyrrole-2-carbaldehyde;2-(1H-pyrrol-2-ylmethylideneamino)ethanamine |
| SMILES | NCC/N=C/c1ccc[nH]1.O=Cc1ccc[nH]1 |
| InChI | InChI=1S/C7H11N3.C5H5NO/c8-3-5-9-6-7-2-1-4-10-7;7-4-5-2-1-3-6-5/h1-2,4,6,10H,3,5,8H2;1-4,6H/b9-6+; |
| InChIKey | PEEVJWZCAPMXNK-MLBSPLJJSA-N |
| XLogP | 1.22 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|