C6H11N3 — CID 55293480
1-(1H-pyrrol-2-yl)ethane-1,2-diamine (PubChem CID 55293480) has the molecular formula C6H11N3 and a molecular weight of 125.17 g/mol. Its IUPAC name is 1-(1H-pyrrol-2-yl)ethane-1,2-diamine.
| Compound Name | 1-(1H-pyrrol-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 55293480 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | 1-(1H-pyrrol-2-yl)ethane-1,2-diamine |
| SMILES | NCC(N)c1ccc[nH]1 |
| InChI | InChI=1S/C6H11N3/c7-4-5(8)6-2-1-3-9-6/h1-3,5,9H,4,7-8H2 |
| InChIKey | SWZORMNAOVTQIB-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 67.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |