C8H15ClN2O — CID 171221255
(4S)-4-amino-4-(1H-pyrrol-2-yl)butan-1-ol;hydrochloride (PubChem CID 171221255) has the molecular formula C8H15ClN2O and a molecular weight of 190.67 g/mol. Its IUPAC name is (4S)-4-amino-4-(1H-pyrrol-2-yl)butan-1-ol;hydrochloride.
| Compound Name | (4S)-4-amino-4-(1H-pyrrol-2-yl)butan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171221255 |
| Molecular Formula | C8H15ClN2O |
| Molecular Weight | 190.67 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | (4S)-4-amino-4-(1H-pyrrol-2-yl)butan-1-ol;hydrochloride |
| SMILES | Cl.N[C@@H](CCCO)c1ccc[nH]1 |
| InChI | InChI=1S/C8H14N2O.ClH/c9-7(3-2-6-11)8-4-1-5-10-8;/h1,4-5,7,10-11H,2-3,6,9H2;1H/t7-;/m0./s1 |
| InChIKey | RSDUFOBLTVZPAV-FJXQXJEOSA-N |
| XLogP | 1.21 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.67 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |