C9H18ClN3 — CID 171201685
(1R)-1-(1H-pyrrol-2-yl)pentane-1,5-diamine;hydrochloride (PubChem CID 171201685) has the molecular formula C9H18ClN3 and a molecular weight of 203.72 g/mol. Its IUPAC name is (1R)-1-(1H-pyrrol-2-yl)pentane-1,5-diamine;hydrochloride.
| Compound Name | (1R)-1-(1H-pyrrol-2-yl)pentane-1,5-diamine;hydrochloride |
|---|---|
| PubChem CID | 171201685 |
| Molecular Formula | C9H18ClN3 |
| Molecular Weight | 203.72 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | (1R)-1-(1H-pyrrol-2-yl)pentane-1,5-diamine;hydrochloride |
| SMILES | Cl.NCCCC[C@@H](N)c1ccc[nH]1 |
| InChI | InChI=1S/C9H17N3.ClH/c10-6-2-1-4-8(11)9-5-3-7-12-9;/h3,5,7-8,12H,1-2,4,6,10-11H2;1H/t8-;/m1./s1 |
| InChIKey | XVVAIBSGRAAIJQ-DDWIOCJRSA-N |
| XLogP | 1.57 |
| TPSA | 67.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.72 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|