C10H19N3 — CID 116905151
N,N-dimethyl-1-(1H-pyrrol-2-yl)butane-1,4-diamine (PubChem CID 116905151) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is N,N-dimethyl-1-(1H-pyrrol-2-yl)butane-1,4-diamine.
| Compound Name | N,N-dimethyl-1-(1H-pyrrol-2-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 116905151 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | N,N-dimethyl-1-(1H-pyrrol-2-yl)butane-1,4-diamine |
| SMILES | CN(C)C(CCCN)c1ccc[nH]1 |
| InChI | InChI=1S/C10H19N3/c1-13(2)10(6-3-7-11)9-5-4-8-12-9/h4-5,8,10,12H,3,6-7,11H2,1-2H3 |
| InChIKey | BNAXOOHNRDTDDH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |