C14H27N3 — CID 82041457
N,N-dibutyl-1-(1H-pyrrol-2-yl)ethane-1,2-diamine (PubChem CID 82041457) has the molecular formula C14H27N3 and a molecular weight of 237.39 g/mol. Its IUPAC name is N,N-dibutyl-1-(1H-pyrrol-2-yl)ethane-1,2-diamine.
| Compound Name | N,N-dibutyl-1-(1H-pyrrol-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 82041457 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | N,N-dibutyl-1-(1H-pyrrol-2-yl)ethane-1,2-diamine |
| SMILES | CCCCN(CCCC)C(CN)c1ccc[nH]1 |
| InChI | InChI=1S/C14H27N3/c1-3-5-10-17(11-6-4-2)14(12-15)13-8-7-9-16-13/h7-9,14,16H,3-6,10-12,15H2,1-2H3 |
| InChIKey | UPMVNMBDYHCOHH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |