C15H27N3 — CID 43125913
N,N-dibutyl-1-pyridin-3-ylethane-1,2-diamine (PubChem CID 43125913) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is N,N-dibutyl-1-pyridin-3-ylethane-1,2-diamine.
| Compound Name | N,N-dibutyl-1-pyridin-3-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 43125913 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | N,N-dibutyl-1-pyridin-3-ylethane-1,2-diamine |
| SMILES | CCCCN(CCCC)C(CN)c1cccnc1 |
| InChI | InChI=1S/C15H27N3/c1-3-5-10-18(11-6-4-2)15(12-16)14-8-7-9-17-13-14/h7-9,13,15H,3-6,10-12,16H2,1-2H3 |
| InChIKey | KUJVXFOBDGGLAA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |