C14H28N4 — CID 43125888
N,N-dibutyl-1-(1-methylpyrazol-4-yl)ethane-1,2-diamine (PubChem CID 43125888) has the molecular formula C14H28N4 and a molecular weight of 252.41 g/mol. Its IUPAC name is N,N-dibutyl-1-(1-methylpyrazol-4-yl)ethane-1,2-diamine.
| Compound Name | N,N-dibutyl-1-(1-methylpyrazol-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 43125888 |
| Molecular Formula | C14H28N4 |
| Molecular Weight | 252.41 g/mol |
| Exact Mass | 252.23 |
| IUPAC Name | N,N-dibutyl-1-(1-methylpyrazol-4-yl)ethane-1,2-diamine |
| SMILES | CCCCN(CCCC)C(CN)c1cnn(C)c1 |
| InChI | InChI=1S/C14H28N4/c1-4-6-8-18(9-7-5-2)14(10-15)13-11-16-17(3)12-13/h11-12,14H,4-10,15H2,1-3H3 |
| InChIKey | YFJDCNDHQWEXST-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |