C7H9F3N2 — CID 34364265
(2S)-3,3,3-trifluoro-2-(1H-pyrrol-2-yl)propan-1-amine (PubChem CID 34364265) has the molecular formula C7H9F3N2 and a molecular weight of 178.16 g/mol. Its IUPAC name is (2S)-3,3,3-trifluoro-2-(1H-pyrrol-2-yl)propan-1-amine.
| Compound Name | (2S)-3,3,3-trifluoro-2-(1H-pyrrol-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 34364265 |
| Molecular Formula | C7H9F3N2 |
| Molecular Weight | 178.16 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | (2S)-3,3,3-trifluoro-2-(1H-pyrrol-2-yl)propan-1-amine |
| SMILES | NC[C@@H](c1ccc[nH]1)C(F)(F)F |
| InChI | InChI=1S/C7H9F3N2/c8-7(9,10)5(4-11)6-2-1-3-12-6/h1-3,5,12H,4,11H2/t5-/m0/s1 |
| InChIKey | MELZBDZZXYFOEF-YFKPBYRVSA-N |
| XLogP | 1.62 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.16 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |