C16H22N2 — CID 82293454
2-(4-tert-butylphenyl)-2-(1H-pyrrol-2-yl)ethanamine (PubChem CID 82293454) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-2-(1H-pyrrol-2-yl)ethanamine.
| Compound Name | 2-(4-tert-butylphenyl)-2-(1H-pyrrol-2-yl)ethanamine |
|---|---|
| PubChem CID | 82293454 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 2-(4-tert-butylphenyl)-2-(1H-pyrrol-2-yl)ethanamine |
| SMILES | CC(C)(C)c1ccc(C(CN)c2ccc[nH]2)cc1 |
| InChI | InChI=1S/C16H22N2/c1-16(2,3)13-8-6-12(7-9-13)14(11-17)15-5-4-10-18-15/h4-10,14,18H,11,17H2,1-3H3 |
| InChIKey | CYQCTPJGGVNNKZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |