About methane;3-propan-2-yl-1H-pyridin-2-one
methane;3-propan-2-yl-1H-pyridin-2-one (PubChem CID 159076813) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is methane;3-propan-2-yl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | methane;3-propan-2-yl-1H-pyridin-2-one |
| PubChem CID | 159076813 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | methane;3-propan-2-yl-1H-pyridin-2-one |
| SMILES | C.C.CC(C)c1ccc[nH]c1=O |
| InChI | InChI=1S/C8H11NO.2CH4/c1-6(2)7-4-3-5-9-8(7)10;;/h3-6H,1-2H3,(H,9,10);2*1H4 |
| InChIKey | KAIVCYGDYMMEMU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methane;3-propan-2-yl-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;3-propan-2-yl-1H-pyridin-2-one?
The IUPAC name of methane;3-propan-2-yl-1H-pyridin-2-one (CID 159076813) is methane;3-propan-2-yl-1H-pyridin-2-one.
What is the SMILES notation for methane;3-propan-2-yl-1H-pyridin-2-one?
The canonical SMILES for methane;3-propan-2-yl-1H-pyridin-2-one is C.C.CC(C)c1ccc[nH]c1=O.
What is the InChIKey of methane;3-propan-2-yl-1H-pyridin-2-one?
The InChIKey is KAIVCYGDYMMEMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO.2CH4/c1-6(2)7-4-3-5-9-8(7)10;;/h3-6H,1-2H3,(H,9,10);2*1H4.
What are the key properties of methane;3-propan-2-yl-1H-pyridin-2-one?
methane;3-propan-2-yl-1H-pyridin-2-one has a molecular weight of 169.27 g/mol, XLogP of 2.77, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;3-propan-2-yl-1H-pyridin-2-one is sourced from PubChem (CID 159076813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).