C7H6ClF2NO — CID 131509867
1-(6-chloro-3-pyridinyl)-2,2-difluoroethanol (PubChem CID 131509867) has the molecular formula C7H6ClF2NO and a molecular weight of 193.58 g/mol. Its IUPAC name is 1-(6-chloro-3-pyridinyl)-2,2-difluoroethanol.
| Compound Name | 1-(6-chloro-3-pyridinyl)-2,2-difluoroethanol |
|---|---|
| PubChem CID | 131509867 |
| Molecular Formula | C7H6ClF2NO |
| Molecular Weight | 193.58 g/mol |
| Exact Mass | 193.01 |
| IUPAC Name | 1-(6-chloro-3-pyridinyl)-2,2-difluoroethanol |
| SMILES | OC(c1ccc(Cl)nc1)C(F)F |
| InChI | InChI=1S/C7H6ClF2NO/c8-5-2-1-4(3-11-5)6(12)7(9)10/h1-3,6-7,12H |
| InChIKey | JPZMTTNLWDHMTQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.58 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|