C8H7ClF2O2 — CID 80605831
2-chloro-4-(2,2-difluoro-1-hydroxyethyl)phenol (PubChem CID 80605831) has the molecular formula C8H7ClF2O2 and a molecular weight of 208.59 g/mol. Its IUPAC name is 2-chloro-4-(2,2-difluoro-1-hydroxyethyl)phenol.
| Compound Name | 2-chloro-4-(2,2-difluoro-1-hydroxyethyl)phenol |
|---|---|
| PubChem CID | 80605831 |
| Molecular Formula | C8H7ClF2O2 |
| Molecular Weight | 208.59 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | 2-chloro-4-(2,2-difluoro-1-hydroxyethyl)phenol |
| SMILES | Oc1ccc(C(O)C(F)F)cc1Cl |
| InChI | InChI=1S/C8H7ClF2O2/c9-5-3-4(1-2-6(5)12)7(13)8(10)11/h1-3,7-8,12-13H |
| InChIKey | GWTSBZKVDQJKBS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.59 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |