C10H13Cl2NO2 — CID 171893518
4-chloro-1-(2-chloro-4-methyl-3-pyridinyl)butane-1,2-diol (PubChem CID 171893518) has the molecular formula C10H13Cl2NO2 and a molecular weight of 250.12 g/mol. Its IUPAC name is 4-chloro-1-(2-chloro-4-methyl-3-pyridinyl)butane-1,2-diol.
| Compound Name | 4-chloro-1-(2-chloro-4-methyl-3-pyridinyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171893518 |
| Molecular Formula | C10H13Cl2NO2 |
| Molecular Weight | 250.12 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | 4-chloro-1-(2-chloro-4-methyl-3-pyridinyl)butane-1,2-diol |
| SMILES | Cc1ccnc(Cl)c1C(O)C(O)CCCl |
| InChI | InChI=1S/C10H13Cl2NO2/c1-6-3-5-13-10(12)8(6)9(15)7(14)2-4-11/h3,5,7,9,14-15H,2,4H2,1H3 |
| InChIKey | LRQVLVXCIPTTTI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.12 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|