C11H18ClNO — CID 171209897
(4R)-4-amino-4-(3-methylphenyl)butan-1-ol;hydrochloride (PubChem CID 171209897) has the molecular formula C11H18ClNO and a molecular weight of 215.72 g/mol. Its IUPAC name is (4R)-4-amino-4-(3-methylphenyl)butan-1-ol;hydrochloride.
| Compound Name | (4R)-4-amino-4-(3-methylphenyl)butan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171209897 |
| Molecular Formula | C11H18ClNO |
| Molecular Weight | 215.72 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | (4R)-4-amino-4-(3-methylphenyl)butan-1-ol;hydrochloride |
| SMILES | Cc1cccc([C@H](N)CCCO)c1.Cl |
| InChI | InChI=1S/C11H17NO.ClH/c1-9-4-2-5-10(8-9)11(12)6-3-7-13;/h2,4-5,8,11,13H,3,6-7,12H2,1H3;1H/t11-;/m1./s1 |
| InChIKey | ZYBMEUWXWOHUPS-RFVHGSKJSA-N |
| XLogP | 2.19 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.72 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |