C15H22F3N3 — CID 7443492
4-methyl-N-[(2S)-1-[3-(trifluoromethyl)phenyl]propan-2-yl]piperazin-1-amine (PubChem CID 7443492) has the molecular formula C15H22F3N3 and a molecular weight of 301.36 g/mol. Its IUPAC name is 4-methyl-N-[(2S)-1-[3-(trifluoromethyl)phenyl]propan-2-yl]piperazin-1-amine.
| Compound Name | 4-methyl-N-[(2S)-1-[3-(trifluoromethyl)phenyl]propan-2-yl]piperazin-1-amine |
|---|---|
| PubChem CID | 7443492 |
| Molecular Formula | C15H22F3N3 |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 4-methyl-N-[(2S)-1-[3-(trifluoromethyl)phenyl]propan-2-yl]piperazin-1-amine |
| SMILES | C[C@@H](Cc1cccc(C(F)(F)F)c1)NN1CCN(C)CC1 |
| InChI | InChI=1S/C15H22F3N3/c1-12(19-21-8-6-20(2)7-9-21)10-13-4-3-5-14(11-13)15(16,17)18/h3-5,11-12,19H,6-10H2,1-2H3/t12-/m0/s1 |
| InChIKey | PPIUQZCZOOOTQM-LBPRGKRZSA-N |
| XLogP | 2.39 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |