C48H62N4O4 — CID 67992353
1-N,2-N,3-N,4-N-tetrakis(4-tert-butylphenyl)butane-1,2,3,4-tetracarboxamide (PubChem CID 67992353) has the molecular formula C48H62N4O4 and a molecular weight of 759.05 g/mol. Its IUPAC name is 1-N,2-N,3-N,4-N-tetrakis(4-tert-butylphenyl)butane-1,2,3,4-tetracarboxamide.
| Compound Name | 1-N,2-N,3-N,4-N-tetrakis(4-tert-butylphenyl)butane-1,2,3,4-tetracarboxamide |
|---|---|
| PubChem CID | 67992353 |
| Molecular Formula | C48H62N4O4 |
| Molecular Weight | 759.05 g/mol |
| Exact Mass | 758.48 |
| IUPAC Name | 1-N,2-N,3-N,4-N-tetrakis(4-tert-butylphenyl)butane-1,2,3,4-tetracarboxamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)CC(C(=O)Nc2ccc(C(C)(C)C)cc2)C(CC(=O)Nc2ccc(C(C)(C)C)cc2)C(=O)Nc2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C48H62N4O4/c1-45(2,3)31-13-21-35(22-14-31)49-41(53)29-39(43(55)51-37-25-17-33(18-26-37)47(7,8)9)40(44(56)52-38-27-19-34(20-28-38)48(10,11)12)30-42(54)50-36-23-15-32(16-24-36)46(4,5)6/h13-28,39-40H,29-30H2,1-12H3,(H,49,53)(H,50,54)(H,51,55)(H,52,56) |
| InChIKey | HGQJBUGOJIBVAZ-UHFFFAOYSA-N |
| XLogP | 10.74 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.05 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |