C23H31N2O2+ — CID 8875841
cyclopentyl-dimethyl-[(2R)-1-oxo-1-(4-phenylmethoxyanilino)propan-2-yl]azanium (PubChem CID 8875841) has the molecular formula C23H31N2O2+ and a molecular weight of 367.51 g/mol. Its IUPAC name is cyclopentyl-dimethyl-[(2R)-1-oxo-1-(4-phenylmethoxyanilino)propan-2-yl]azanium.
| Compound Name | cyclopentyl-dimethyl-[(2R)-1-oxo-1-(4-phenylmethoxyanilino)propan-2-yl]azanium |
|---|---|
| PubChem CID | 8875841 |
| Molecular Formula | C23H31N2O2+ |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | cyclopentyl-dimethyl-[(2R)-1-oxo-1-(4-phenylmethoxyanilino)propan-2-yl]azanium |
| SMILES | C[C@H](C(=O)Nc1ccc(OCc2ccccc2)cc1)[N+](C)(C)C1CCCC1 |
| InChI | InChI=1S/C23H30N2O2/c1-18(25(2,3)21-11-7-8-12-21)23(26)24-20-13-15-22(16-14-20)27-17-19-9-5-4-6-10-19/h4-6,9-10,13-16,18,21H,7-8,11-12,17H2,1-3H3/p+1/t18-/m1/s1 |
| InChIKey | NIHYXBVDHGBZPE-GOSISDBHSA-O |
| XLogP | 4.61 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|