C16H17Cl2NO — CID 100824173
(1S,3S,6S,7R,9S)-N-(2,4-dichlorophenyl)tricyclo[4.3.0.03,9]nonane-7-carboxamide (PubChem CID 100824173) has the molecular formula C16H17Cl2NO and a molecular weight of 310.22 g/mol. Its IUPAC name is (1S,3S,6S,7R,9S)-N-(2,4-dichlorophenyl)tricyclo[4.3.0.03,9]nonane-7-carboxamide.
| Compound Name | (1S,3S,6S,7R,9S)-N-(2,4-dichlorophenyl)tricyclo[4.3.0.03,9]nonane-7-carboxamide |
|---|---|
| PubChem CID | 100824173 |
| Molecular Formula | C16H17Cl2NO |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | (1S,3S,6S,7R,9S)-N-(2,4-dichlorophenyl)tricyclo[4.3.0.03,9]nonane-7-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)[C@@H]1C[C@H]2[C@H]3CC[C@H]1[C@H]2C3 |
| InChI | InChI=1S/C16H17Cl2NO/c17-9-2-4-15(14(18)6-9)19-16(20)13-7-11-8-1-3-10(13)12(11)5-8/h2,4,6,8,10-13H,1,3,5,7H2,(H,19,20)/t8-,10-,11-,12+,13+/m0/s1 |
| InChIKey | XROMWFGFPUQVOV-KHAFSYESSA-N |
| XLogP | 4.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |