C17H19Cl2NO — CID 100824124
(1R,4S,5R,7R,8S)-N-(2,4-dichlorophenyl)tricyclo[5.2.1.04,8]decane-5-carboxamide (PubChem CID 100824124) has the molecular formula C17H19Cl2NO and a molecular weight of 324.25 g/mol. Its IUPAC name is (1R,4S,5R,7R,8S)-N-(2,4-dichlorophenyl)tricyclo[5.2.1.04,8]decane-5-carboxamide.
| Compound Name | (1R,4S,5R,7R,8S)-N-(2,4-dichlorophenyl)tricyclo[5.2.1.04,8]decane-5-carboxamide |
|---|---|
| PubChem CID | 100824124 |
| Molecular Formula | C17H19Cl2NO |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | (1R,4S,5R,7R,8S)-N-(2,4-dichlorophenyl)tricyclo[5.2.1.04,8]decane-5-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)[C@@H]1C[C@H]2C[C@H]3CC[C@H]1[C@H]2C3 |
| InChI | InChI=1S/C17H19Cl2NO/c18-11-2-4-16(15(19)8-11)20-17(21)14-7-10-5-9-1-3-12(14)13(10)6-9/h2,4,8-10,12-14H,1,3,5-7H2,(H,20,21)/t9-,10-,12+,13+,14-/m1/s1 |
| InChIKey | OQECFXTZPDECGI-SJVBDLOYSA-N |
| XLogP | 5.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |