C14H16ClNO — CID 4069270
N-(2-chlorophenyl)bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 4069270) has the molecular formula C14H16ClNO and a molecular weight of 249.74 g/mol. Its IUPAC name is N-(2-chlorophenyl)bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | N-(2-chlorophenyl)bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 4069270 |
| Molecular Formula | C14H16ClNO |
| Molecular Weight | 249.74 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | N-(2-chlorophenyl)bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | O=C(Nc1ccccc1Cl)C1CC2CCC1C2 |
| InChI | InChI=1S/C14H16ClNO/c15-12-3-1-2-4-13(12)16-14(17)11-8-9-5-6-10(11)7-9/h1-4,9-11H,5-8H2,(H,16,17) |
| InChIKey | NGRGFMSDCZADET-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.74 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |