C13H15ClN2O — CID 98296679
(1R,2R,4R)-N-(2-chloro-3-pyridinyl)bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 98296679) has the molecular formula C13H15ClN2O and a molecular weight of 250.73 g/mol. Its IUPAC name is (1R,2R,4R)-N-(2-chloro-3-pyridinyl)bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1R,2R,4R)-N-(2-chloro-3-pyridinyl)bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 98296679 |
| Molecular Formula | C13H15ClN2O |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | (1R,2R,4R)-N-(2-chloro-3-pyridinyl)bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | O=C(Nc1cccnc1Cl)[C@@H]1C[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C13H15ClN2O/c14-12-11(2-1-5-15-12)16-13(17)10-7-8-3-4-9(10)6-8/h1-2,5,8-10H,3-4,6-7H2,(H,16,17)/t8-,9-,10-/m1/s1 |
| InChIKey | PSNALDDCULJAAT-OPRDCNLKSA-N |
| XLogP | 3.11 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|