C13H16N2O — CID 98329182
(1S,2S,4S)-N-pyridin-2-ylbicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 98329182) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is (1S,2S,4S)-N-pyridin-2-ylbicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S,2S,4S)-N-pyridin-2-ylbicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 98329182 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | (1S,2S,4S)-N-pyridin-2-ylbicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | O=C(Nc1ccccn1)[C@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C13H16N2O/c16-13(15-12-3-1-2-6-14-12)11-8-9-4-5-10(11)7-9/h1-3,6,9-11H,4-5,7-8H2,(H,14,15,16)/t9-,10-,11-/m0/s1 |
| InChIKey | ICUGUWHKSGQUFZ-DCAQKATOSA-N |
| XLogP | 2.46 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |