C18H22N2O2S — CID 102559631
S-[4-(tricyclo[3.2.1.02,4]octane-3-carbonylamino)phenyl] N,N-dimethylcarbamothioate (PubChem CID 102559631) has the molecular formula C18H22N2O2S and a molecular weight of 330.45 g/mol. Its IUPAC name is S-[4-(tricyclo[3.2.1.02,4]octane-3-carbonylamino)phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[4-(tricyclo[3.2.1.02,4]octane-3-carbonylamino)phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 102559631 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | S-[4-(tricyclo[3.2.1.02,4]octane-3-carbonylamino)phenyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)Sc1ccc(NC(=O)C2C3C4CCC(C4)C23)cc1 |
| InChI | InChI=1S/C18H22N2O2S/c1-20(2)18(22)23-13-7-5-12(6-8-13)19-17(21)16-14-10-3-4-11(9-10)15(14)16/h5-8,10-11,14-16H,3-4,9H2,1-2H3,(H,19,21) |
| InChIKey | NASXKEKUIUCRLK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|