C20H24ClNO — CID 7720013
(1R,4Z,8E,12S)-N-(4-chlorophenyl)bicyclo[10.1.0]trideca-4,8-diene-13-carboxamide (PubChem CID 7720013) has the molecular formula C20H24ClNO and a molecular weight of 329.87 g/mol. Its IUPAC name is (1R,4Z,8E,12S)-N-(4-chlorophenyl)bicyclo[10.1.0]trideca-4,8-diene-13-carboxamide.
| Compound Name | (1R,4Z,8E,12S)-N-(4-chlorophenyl)bicyclo[10.1.0]trideca-4,8-diene-13-carboxamide |
|---|---|
| PubChem CID | 7720013 |
| Molecular Formula | C20H24ClNO |
| Molecular Weight | 329.87 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | (1R,4Z,8E,12S)-N-(4-chlorophenyl)bicyclo[10.1.0]trideca-4,8-diene-13-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)C1[C@H]2CC/C=C/CC/C=C\CC[C@@H]12 |
| InChI | InChI=1S/C20H24ClNO/c21-15-11-13-16(14-12-15)22-20(23)19-17-9-7-5-3-1-2-4-6-8-10-18(17)19/h3-6,11-14,17-19H,1-2,7-10H2,(H,22,23)/b5-3-,6-4+/t17-,18+,19?/m1/s1 |
| InChIKey | XYFUVLIWAXYEIS-AEJYPDECSA-N |
| XLogP | 5.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.87 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|