C18H21NO2 — CID 5392551
(1R,4Z,8R)-N-(4-acetylphenyl)bicyclo[6.1.0]non-4-ene-9-carboxamide (PubChem CID 5392551) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is (1R,4Z,8R)-N-(4-acetylphenyl)bicyclo[6.1.0]non-4-ene-9-carboxamide.
| Compound Name | (1R,4Z,8R)-N-(4-acetylphenyl)bicyclo[6.1.0]non-4-ene-9-carboxamide |
|---|---|
| PubChem CID | 5392551 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (1R,4Z,8R)-N-(4-acetylphenyl)bicyclo[6.1.0]non-4-ene-9-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)C2[C@@H]3CC/C=C\CC[C@@H]23)cc1 |
| InChI | InChI=1S/C18H21NO2/c1-12(20)13-8-10-14(11-9-13)19-18(21)17-15-6-4-2-3-5-7-16(15)17/h2-3,8-11,15-17H,4-7H2,1H3,(H,19,21)/b3-2-/t15-,16-/m1/s1 |
| InChIKey | JXZJEKZWRPLWPV-INQOVCNISA-N |
| XLogP | 3.82 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|