C17H21F3N2O2 — CID 119276081
N-[4-(2,2,2-trifluoroethoxy)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 119276081) has the molecular formula C17H21F3N2O2 and a molecular weight of 342.36 g/mol. Its IUPAC name is N-[4-(2,2,2-trifluoroethoxy)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-[4-(2,2,2-trifluoroethoxy)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 119276081 |
| Molecular Formula | C17H21F3N2O2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | N-[4-(2,2,2-trifluoroethoxy)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | O=C(Nc1ccc(OCC(F)(F)F)cc1)C1CC2CCCCC2N1 |
| InChI | InChI=1S/C17H21F3N2O2/c18-17(19,20)10-24-13-7-5-12(6-8-13)21-16(23)15-9-11-3-1-2-4-14(11)22-15/h5-8,11,14-15,22H,1-4,9-10H2,(H,21,23) |
| InChIKey | IYHMPOOWENIBHQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |