C17H22F3N3O2 — CID 119847130
N-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 119847130) has the molecular formula C17H22F3N3O2 and a molecular weight of 357.38 g/mol. Its IUPAC name is N-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 119847130 |
| Molecular Formula | C17H22F3N3O2 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | N-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | O=C(NCc1cccnc1OCC(F)(F)F)C1CC2CCCCC2N1 |
| InChI | InChI=1S/C17H22F3N3O2/c18-17(19,20)10-25-16-12(5-3-7-21-16)9-22-15(24)14-8-11-4-1-2-6-13(11)23-14/h3,5,7,11,13-14,23H,1-2,4,6,8-10H2,(H,22,24) |
| InChIKey | RSZAXGKKQWZKAW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |