C29H32N4O2 — CID 25120628
2-oxo-2-(2-phenyl-5,6,7,8-tetrahydroindolizin-3-yl)-N-[4-(4-prop-2-enylpiperazin-1-yl)phenyl]acetamide (PubChem CID 25120628) has the molecular formula C29H32N4O2 and a molecular weight of 468.60 g/mol. Its IUPAC name is 2-oxo-2-(2-phenyl-5,6,7,8-tetrahydroindolizin-3-yl)-N-[4-(4-prop-2-enylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-oxo-2-(2-phenyl-5,6,7,8-tetrahydroindolizin-3-yl)-N-[4-(4-prop-2-enylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 25120628 |
| Molecular Formula | C29H32N4O2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 2-oxo-2-(2-phenyl-5,6,7,8-tetrahydroindolizin-3-yl)-N-[4-(4-prop-2-enylpiperazin-1-yl)phenyl]acetamide |
| SMILES | C=CCN1CCN(c2ccc(NC(=O)C(=O)c3c(-c4ccccc4)cc4n3CCCC4)cc2)CC1 |
| InChI | InChI=1S/C29H32N4O2/c1-2-15-31-17-19-32(20-18-31)24-13-11-23(12-14-24)30-29(35)28(34)27-26(22-8-4-3-5-9-22)21-25-10-6-7-16-33(25)27/h2-5,8-9,11-14,21H,1,6-7,10,15-20H2,(H,30,35) |
| InChIKey | JEKGQYNOXNYHKT-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|