C29H38N4O2 — CID 25121317
2-(2-cyclopentyl-5,6,7,8-tetrahydroindolizin-3-yl)-N-[4-[4-(2-methylprop-2-enyl)piperazin-1-yl]phenyl]-2-oxoacetamide (PubChem CID 25121317) has the molecular formula C29H38N4O2 and a molecular weight of 474.65 g/mol. Its IUPAC name is 2-(2-cyclopentyl-5,6,7,8-tetrahydroindolizin-3-yl)-N-[4-[4-(2-methylprop-2-enyl)piperazin-1-yl]phenyl]-2-oxoacetamide.
| Compound Name | 2-(2-cyclopentyl-5,6,7,8-tetrahydroindolizin-3-yl)-N-[4-[4-(2-methylprop-2-enyl)piperazin-1-yl]phenyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 25121317 |
| Molecular Formula | C29H38N4O2 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | 2-(2-cyclopentyl-5,6,7,8-tetrahydroindolizin-3-yl)-N-[4-[4-(2-methylprop-2-enyl)piperazin-1-yl]phenyl]-2-oxoacetamide |
| SMILES | C=C(C)CN1CCN(c2ccc(NC(=O)C(=O)c3c(C4CCCC4)cc4n3CCCC4)cc2)CC1 |
| InChI | InChI=1S/C29H38N4O2/c1-21(2)20-31-15-17-32(18-16-31)24-12-10-23(11-13-24)30-29(35)28(34)27-26(22-7-3-4-8-22)19-25-9-5-6-14-33(25)27/h10-13,19,22H,1,3-9,14-18,20H2,2H3,(H,30,35) |
| InChIKey | TXQQLVHGJNZREV-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|