C30H31N5O2 — CID 67238906
2-(1,5-dimethyl-3-phenylpyrrol-2-yl)-N-[4-[4-(5-methyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-oxoacetamide (PubChem CID 67238906) has the molecular formula C30H31N5O2 and a molecular weight of 493.61 g/mol. Its IUPAC name is 2-(1,5-dimethyl-3-phenylpyrrol-2-yl)-N-[4-[4-(5-methyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-oxoacetamide.
| Compound Name | 2-(1,5-dimethyl-3-phenylpyrrol-2-yl)-N-[4-[4-(5-methyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 67238906 |
| Molecular Formula | C30H31N5O2 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | 2-(1,5-dimethyl-3-phenylpyrrol-2-yl)-N-[4-[4-(5-methyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-oxoacetamide |
| SMILES | Cc1ccc(N2CCN(c3ccc(NC(=O)C(=O)c4c(-c5ccccc5)cc(C)n4C)cc3)CC2)nc1 |
| InChI | InChI=1S/C30H31N5O2/c1-21-9-14-27(31-20-21)35-17-15-34(16-18-35)25-12-10-24(11-13-25)32-30(37)29(36)28-26(19-22(2)33(28)3)23-7-5-4-6-8-23/h4-14,19-20H,15-18H2,1-3H3,(H,32,37) |
| InChIKey | HGEBYMJEHCWKMZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|