C34H33N5O2 — CID 67326733
N-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-(7-methyl-2-phenylindolizin-3-yl)-2-oxoacetamide (PubChem CID 67326733) has the molecular formula C34H33N5O2 and a molecular weight of 543.67 g/mol. Its IUPAC name is N-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-(7-methyl-2-phenylindolizin-3-yl)-2-oxoacetamide.
| Compound Name | N-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-(7-methyl-2-phenylindolizin-3-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 67326733 |
| Molecular Formula | C34H33N5O2 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | N-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-(7-methyl-2-phenylindolizin-3-yl)-2-oxoacetamide |
| SMILES | Cc1cc(C)nc(N2CCN(c3ccc(NC(=O)C(=O)c4c(-c5ccccc5)cc5cc(C)ccn45)cc3)CC2)c1 |
| InChI | InChI=1S/C34H33N5O2/c1-23-13-14-39-29(20-23)22-30(26-7-5-4-6-8-26)32(39)33(40)34(41)36-27-9-11-28(12-10-27)37-15-17-38(18-16-37)31-21-24(2)19-25(3)35-31/h4-14,19-22H,15-18H2,1-3H3,(H,36,41) |
| InChIKey | ZMCVLKUZACCIGZ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 69.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|