C33H38N6O2 — CID 66914873
2-[1-[2-(dimethylamino)ethyl]-3-phenylpyrrol-2-yl]-N-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-oxoacetamide (PubChem CID 66914873) has the molecular formula C33H38N6O2 and a molecular weight of 550.71 g/mol. Its IUPAC name is 2-[1-[2-(dimethylamino)ethyl]-3-phenylpyrrol-2-yl]-N-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-oxoacetamide.
| Compound Name | 2-[1-[2-(dimethylamino)ethyl]-3-phenylpyrrol-2-yl]-N-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 66914873 |
| Molecular Formula | C33H38N6O2 |
| Molecular Weight | 550.71 g/mol |
| Exact Mass | 550.31 |
| IUPAC Name | 2-[1-[2-(dimethylamino)ethyl]-3-phenylpyrrol-2-yl]-N-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-oxoacetamide |
| SMILES | Cc1cc(C)nc(N2CCN(c3ccc(NC(=O)C(=O)c4c(-c5ccccc5)ccn4CCN(C)C)cc3)CC2)c1 |
| InChI | InChI=1S/C33H38N6O2/c1-24-22-25(2)34-30(23-24)38-20-18-37(19-21-38)28-12-10-27(11-13-28)35-33(41)32(40)31-29(26-8-6-5-7-9-26)14-15-39(31)17-16-36(3)4/h5-15,22-23H,16-21H2,1-4H3,(H,35,41) |
| InChIKey | UKVQQACHWJPINJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 73.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.71 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|