C31H31N5O2 — CID 66878541
2-oxo-2-(2-phenyl-5,6,7,8-tetrahydroindolizin-1-yl)-N-[4-(4-pyridin-2-ylpiperazin-1-yl)phenyl]acetamide (PubChem CID 66878541) has the molecular formula C31H31N5O2 and a molecular weight of 505.62 g/mol. Its IUPAC name is 2-oxo-2-(2-phenyl-5,6,7,8-tetrahydroindolizin-1-yl)-N-[4-(4-pyridin-2-ylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-oxo-2-(2-phenyl-5,6,7,8-tetrahydroindolizin-1-yl)-N-[4-(4-pyridin-2-ylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 66878541 |
| Molecular Formula | C31H31N5O2 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | 2-oxo-2-(2-phenyl-5,6,7,8-tetrahydroindolizin-1-yl)-N-[4-(4-pyridin-2-ylpiperazin-1-yl)phenyl]acetamide |
| SMILES | O=C(Nc1ccc(N2CCN(c3ccccn3)CC2)cc1)C(=O)c1c(-c2ccccc2)cn2c1CCCC2 |
| InChI | InChI=1S/C31H31N5O2/c37-30(29-26(23-8-2-1-3-9-23)22-36-17-7-5-10-27(29)36)31(38)33-24-12-14-25(15-13-24)34-18-20-35(21-19-34)28-11-4-6-16-32-28/h1-4,6,8-9,11-16,22H,5,7,10,17-21H2,(H,33,38) |
| InChIKey | NZJJNTOBPQSBSN-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|