C22H21N3O2 — CID 126635426
4-phenyl-3-(4-pyridin-2-ylpiperazin-1-yl)benzoic acid (PubChem CID 126635426) has the molecular formula C22H21N3O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is 4-phenyl-3-(4-pyridin-2-ylpiperazin-1-yl)benzoic acid.
| Compound Name | 4-phenyl-3-(4-pyridin-2-ylpiperazin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 126635426 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 4-phenyl-3-(4-pyridin-2-ylpiperazin-1-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccccc2)c(N2CCN(c3ccccn3)CC2)c1 |
| InChI | InChI=1S/C22H21N3O2/c26-22(27)18-9-10-19(17-6-2-1-3-7-17)20(16-18)24-12-14-25(15-13-24)21-8-4-5-11-23-21/h1-11,16H,12-15H2,(H,26,27) |
| InChIKey | AWBMNFYMOHXMOA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |