C32H37N5O3 — CID 67106882
N-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]-3-(methoxymethyl)phenyl]-2-oxo-2-(2-propan-2-ylindolizin-3-yl)acetamide (PubChem CID 67106882) has the molecular formula C32H37N5O3 and a molecular weight of 539.68 g/mol. Its IUPAC name is N-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]-3-(methoxymethyl)phenyl]-2-oxo-2-(2-propan-2-ylindolizin-3-yl)acetamide.
| Compound Name | N-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]-3-(methoxymethyl)phenyl]-2-oxo-2-(2-propan-2-ylindolizin-3-yl)acetamide |
|---|---|
| PubChem CID | 67106882 |
| Molecular Formula | C32H37N5O3 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.29 |
| IUPAC Name | N-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]-3-(methoxymethyl)phenyl]-2-oxo-2-(2-propan-2-ylindolizin-3-yl)acetamide |
| SMILES | COCc1cc(NC(=O)C(=O)c2c(C(C)C)cc3ccccn23)ccc1N1CCN(c2cc(C)cc(C)n2)CC1 |
| InChI | InChI=1S/C32H37N5O3/c1-21(2)27-19-26-8-6-7-11-37(26)30(27)31(38)32(39)34-25-9-10-28(24(18-25)20-40-5)35-12-14-36(15-13-35)29-17-22(3)16-23(4)33-29/h6-11,16-19,21H,12-15,20H2,1-5H3,(H,34,39) |
| InChIKey | WIIBFPRIOWZEPX-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|