C39H48N6O4 — CID 91276920
2-(1,5-dimethyl-3-phenylpyrrol-2-yl)-N-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]-3-[morpholin-4-yl(propoxy)methyl]phenyl]-2-oxoacetamide (PubChem CID 91276920) has the molecular formula C39H48N6O4 and a molecular weight of 664.85 g/mol. Its IUPAC name is 2-(1,5-dimethyl-3-phenylpyrrol-2-yl)-N-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]-3-[morpholin-4-yl(propoxy)methyl]phenyl]-2-oxoacetamide.
| Compound Name | 2-(1,5-dimethyl-3-phenylpyrrol-2-yl)-N-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]-3-[morpholin-4-yl(propoxy)methyl]phenyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 91276920 |
| Molecular Formula | C39H48N6O4 |
| Molecular Weight | 664.85 g/mol |
| Exact Mass | 664.37 |
| IUPAC Name | 2-(1,5-dimethyl-3-phenylpyrrol-2-yl)-N-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]-3-[morpholin-4-yl(propoxy)methyl]phenyl]-2-oxoacetamide |
| SMILES | CCCOC(c1cc(NC(=O)C(=O)c2c(-c3ccccc3)cc(C)n2C)ccc1N1CCN(c2cc(C)cc(C)n2)CC1)N1CCOCC1 |
| InChI | InChI=1S/C39H48N6O4/c1-6-20-49-39(45-18-21-48-22-19-45)33-26-31(12-13-34(33)43-14-16-44(17-15-43)35-24-27(2)23-28(3)40-35)41-38(47)37(46)36-32(25-29(4)42(36)5)30-10-8-7-9-11-30/h7-13,23-26,39H,6,14-22H2,1-5H3,(H,41,47) |
| InChIKey | ARVBOKUHWVSYGW-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.85 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|