C21H24N6O — CID 119046492
1-(2-methyl-4-pyrazol-1-ylphenyl)-3-(1-pyridin-2-ylpiperidin-4-yl)urea (PubChem CID 119046492) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is 1-(2-methyl-4-pyrazol-1-ylphenyl)-3-(1-pyridin-2-ylpiperidin-4-yl)urea.
| Compound Name | 1-(2-methyl-4-pyrazol-1-ylphenyl)-3-(1-pyridin-2-ylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 119046492 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 1-(2-methyl-4-pyrazol-1-ylphenyl)-3-(1-pyridin-2-ylpiperidin-4-yl)urea |
| SMILES | Cc1cc(-n2cccn2)ccc1NC(=O)NC1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C21H24N6O/c1-16-15-18(27-12-4-11-23-27)6-7-19(16)25-21(28)24-17-8-13-26(14-9-17)20-5-2-3-10-22-20/h2-7,10-12,15,17H,8-9,13-14H2,1H3,(H2,24,25,28) |
| InChIKey | VVHKUDMKWRFQKS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |