C24H23N3O2 — CID 110630969
N-(3-imidazo[1,5-a]pyridin-3-ylpropyl)-4-methoxy-3-phenylbenzamide (PubChem CID 110630969) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is N-(3-imidazo[1,5-a]pyridin-3-ylpropyl)-4-methoxy-3-phenylbenzamide.
| Compound Name | N-(3-imidazo[1,5-a]pyridin-3-ylpropyl)-4-methoxy-3-phenylbenzamide |
|---|---|
| PubChem CID | 110630969 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | N-(3-imidazo[1,5-a]pyridin-3-ylpropyl)-4-methoxy-3-phenylbenzamide |
| SMILES | COc1ccc(C(=O)NCCCc2ncc3ccccn23)cc1-c1ccccc1 |
| InChI | InChI=1S/C24H23N3O2/c1-29-22-13-12-19(16-21(22)18-8-3-2-4-9-18)24(28)25-14-7-11-23-26-17-20-10-5-6-15-27(20)23/h2-6,8-10,12-13,15-17H,7,11,14H2,1H3,(H,25,28) |
| InChIKey | NMNKYMOOACQZIO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|