C21H20N4O — CID 110309684
N-(3-imidazo[1,5-a]pyridin-3-ylpropyl)-3-pyrrol-1-ylbenzamide (PubChem CID 110309684) has the molecular formula C21H20N4O and a molecular weight of 344.42 g/mol. Its IUPAC name is N-(3-imidazo[1,5-a]pyridin-3-ylpropyl)-3-pyrrol-1-ylbenzamide.
| Compound Name | N-(3-imidazo[1,5-a]pyridin-3-ylpropyl)-3-pyrrol-1-ylbenzamide |
|---|---|
| PubChem CID | 110309684 |
| Molecular Formula | C21H20N4O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | N-(3-imidazo[1,5-a]pyridin-3-ylpropyl)-3-pyrrol-1-ylbenzamide |
| SMILES | O=C(NCCCc1ncc2ccccn12)c1cccc(-n2cccc2)c1 |
| InChI | InChI=1S/C21H20N4O/c26-21(17-7-5-9-18(15-17)24-12-3-4-13-24)22-11-6-10-20-23-16-19-8-1-2-14-25(19)20/h1-5,7-9,12-16H,6,10-11H2,(H,22,26) |
| InChIKey | RGSDHDFCCXSEKM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 51.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|