C23H26N4O2 — CID 110309713
1-benzoyl-N-(3-imidazo[1,5-a]pyridin-3-ylpropyl)piperidine-4-carboxamide (PubChem CID 110309713) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 1-benzoyl-N-(3-imidazo[1,5-a]pyridin-3-ylpropyl)piperidine-4-carboxamide.
| Compound Name | 1-benzoyl-N-(3-imidazo[1,5-a]pyridin-3-ylpropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 110309713 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 1-benzoyl-N-(3-imidazo[1,5-a]pyridin-3-ylpropyl)piperidine-4-carboxamide |
| SMILES | O=C(NCCCc1ncc2ccccn12)C1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H26N4O2/c28-22(24-13-6-10-21-25-17-20-9-4-5-14-27(20)21)18-11-15-26(16-12-18)23(29)19-7-2-1-3-8-19/h1-5,7-9,14,17-18H,6,10-13,15-16H2,(H,24,28) |
| InChIKey | SELIGQCKGKFMOW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|