C20H20N2O2 — CID 86972966
N-[3-(4-hydroxyphenyl)propyl]-3-pyrrol-1-ylbenzamide (PubChem CID 86972966) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is N-[3-(4-hydroxyphenyl)propyl]-3-pyrrol-1-ylbenzamide.
| Compound Name | N-[3-(4-hydroxyphenyl)propyl]-3-pyrrol-1-ylbenzamide |
|---|---|
| PubChem CID | 86972966 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | N-[3-(4-hydroxyphenyl)propyl]-3-pyrrol-1-ylbenzamide |
| SMILES | O=C(NCCCc1ccc(O)cc1)c1cccc(-n2cccc2)c1 |
| InChI | InChI=1S/C20H20N2O2/c23-19-10-8-16(9-11-19)5-4-12-21-20(24)17-6-3-7-18(15-17)22-13-1-2-14-22/h1-3,6-11,13-15,23H,4-5,12H2,(H,21,24) |
| InChIKey | IZIWNBCJLKVWJZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|