C24H22N2O3 — CID 86972910
3-[(2-cyanophenyl)methoxy]-N-[3-(4-hydroxyphenyl)propyl]benzamide (PubChem CID 86972910) has the molecular formula C24H22N2O3 and a molecular weight of 386.45 g/mol. Its IUPAC name is 3-[(2-cyanophenyl)methoxy]-N-[3-(4-hydroxyphenyl)propyl]benzamide.
| Compound Name | 3-[(2-cyanophenyl)methoxy]-N-[3-(4-hydroxyphenyl)propyl]benzamide |
|---|---|
| PubChem CID | 86972910 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 3-[(2-cyanophenyl)methoxy]-N-[3-(4-hydroxyphenyl)propyl]benzamide |
| SMILES | N#Cc1ccccc1COc1cccc(C(=O)NCCCc2ccc(O)cc2)c1 |
| InChI | InChI=1S/C24H22N2O3/c25-16-20-6-1-2-7-21(20)17-29-23-9-3-8-19(15-23)24(28)26-14-4-5-18-10-12-22(27)13-11-18/h1-3,6-13,15,27H,4-5,14,17H2,(H,26,28) |
| InChIKey | VSEFLKYIGYWOHO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|