C18H20N4O3S — CID 112500596
4-(dimethylsulfamoyl)-N-(2-imidazo[1,5-a]pyridin-3-ylethyl)benzamide (PubChem CID 112500596) has the molecular formula C18H20N4O3S and a molecular weight of 372.45 g/mol. Its IUPAC name is 4-(dimethylsulfamoyl)-N-(2-imidazo[1,5-a]pyridin-3-ylethyl)benzamide.
| Compound Name | 4-(dimethylsulfamoyl)-N-(2-imidazo[1,5-a]pyridin-3-ylethyl)benzamide |
|---|---|
| PubChem CID | 112500596 |
| Molecular Formula | C18H20N4O3S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 4-(dimethylsulfamoyl)-N-(2-imidazo[1,5-a]pyridin-3-ylethyl)benzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)NCCc2ncc3ccccn23)cc1 |
| InChI | InChI=1S/C18H20N4O3S/c1-21(2)26(24,25)16-8-6-14(7-9-16)18(23)19-11-10-17-20-13-15-5-3-4-12-22(15)17/h3-9,12-13H,10-11H2,1-2H3,(H,19,23) |
| InChIKey | MALKIBKGXBBOHN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |