C18H20N4O3S — CID 110675048
3-imidazo[1,5-a]pyridin-3-yl-N-[2-(4-sulfamoylphenyl)ethyl]propanamide (PubChem CID 110675048) has the molecular formula C18H20N4O3S and a molecular weight of 372.45 g/mol. Its IUPAC name is 3-imidazo[1,5-a]pyridin-3-yl-N-[2-(4-sulfamoylphenyl)ethyl]propanamide.
| Compound Name | 3-imidazo[1,5-a]pyridin-3-yl-N-[2-(4-sulfamoylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 110675048 |
| Molecular Formula | C18H20N4O3S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 3-imidazo[1,5-a]pyridin-3-yl-N-[2-(4-sulfamoylphenyl)ethyl]propanamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)CCc2ncc3ccccn23)cc1 |
| InChI | InChI=1S/C18H20N4O3S/c19-26(24,25)16-6-4-14(5-7-16)10-11-20-18(23)9-8-17-21-13-15-3-1-2-12-22(15)17/h1-7,12-13H,8-11H2,(H,20,23)(H2,19,24,25) |
| InChIKey | HPHFTIFMQHQIKF-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |