C28H24N3O2S+ — CID 5234700
2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-(4-phenoxyphenyl)acetamide (PubChem CID 5234700) has the molecular formula C28H24N3O2S+ and a molecular weight of 466.59 g/mol. Its IUPAC name is 2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-(4-phenoxyphenyl)acetamide.
| Compound Name | 2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-(4-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 5234700 |
| Molecular Formula | C28H24N3O2S+ |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-(4-phenoxyphenyl)acetamide |
| SMILES | O=C(CSc1[nH]c2ccccc2[n+]1Cc1ccccc1)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C28H23N3O2S/c32-27(29-22-15-17-24(18-16-22)33-23-11-5-2-6-12-23)20-34-28-30-25-13-7-8-14-26(25)31(28)19-21-9-3-1-4-10-21/h1-18H,19-20H2,(H,29,32)/p+1 |
| InChIKey | PGFMXWOMLPXILU-UHFFFAOYSA-O |
| XLogP | 6.03 |
| TPSA | 58.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|