C34H34N5O2S+ — CID 4570461
2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-[4-[4-(3-methylbenzoyl)piperazin-1-yl]phenyl]acetamide (PubChem CID 4570461) has the molecular formula C34H34N5O2S+ and a molecular weight of 576.75 g/mol. Its IUPAC name is 2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-[4-[4-(3-methylbenzoyl)piperazin-1-yl]phenyl]acetamide.
| Compound Name | 2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-[4-[4-(3-methylbenzoyl)piperazin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 4570461 |
| Molecular Formula | C34H34N5O2S+ |
| Molecular Weight | 576.75 g/mol |
| Exact Mass | 576.24 |
| IUPAC Name | 2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-[4-[4-(3-methylbenzoyl)piperazin-1-yl]phenyl]acetamide |
| SMILES | Cc1cccc(C(=O)N2CCN(c3ccc(NC(=O)CSc4[nH]c5ccccc5[n+]4Cc4ccccc4)cc3)CC2)c1 |
| InChI | InChI=1S/C34H33N5O2S/c1-25-8-7-11-27(22-25)33(41)38-20-18-37(19-21-38)29-16-14-28(15-17-29)35-32(40)24-42-34-36-30-12-5-6-13-31(30)39(34)23-26-9-3-2-4-10-26/h2-17,22H,18-21,23-24H2,1H3,(H,35,40)/p+1 |
| InChIKey | GPZCPAOPHOUMEH-UHFFFAOYSA-O |
| XLogP | 5.51 |
| TPSA | 72.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.75 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|