C22H20N3O2S+ — CID 3969279
2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-(2-hydroxyphenyl)acetamide (PubChem CID 3969279) has the molecular formula C22H20N3O2S+ and a molecular weight of 390.49 g/mol. Its IUPAC name is 2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-(2-hydroxyphenyl)acetamide.
| Compound Name | 2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-(2-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 3969279 |
| Molecular Formula | C22H20N3O2S+ |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-(2-hydroxyphenyl)acetamide |
| SMILES | O=C(CSc1[nH]c2ccccc2[n+]1Cc1ccccc1)Nc1ccccc1O |
| InChI | InChI=1S/C22H19N3O2S/c26-20-13-7-5-11-18(20)23-21(27)15-28-22-24-17-10-4-6-12-19(17)25(22)14-16-8-2-1-3-9-16/h1-13H,14-15H2,(H2,23,26,27)/p+1 |
| InChIKey | OYLQROJOCYDJBT-UHFFFAOYSA-O |
| XLogP | 3.94 |
| TPSA | 69.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|