C18H20N3OS+ — CID 3544867
N-(2,3-dimethylphenyl)-2-[(3-methyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]acetamide (PubChem CID 3544867) has the molecular formula C18H20N3OS+ and a molecular weight of 326.45 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-[(3-methyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-[(3-methyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 3544867 |
| Molecular Formula | C18H20N3OS+ |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-[(3-methyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]acetamide |
| SMILES | Cc1cccc(NC(=O)CSc2[nH]c3ccccc3[n+]2C)c1C |
| InChI | InChI=1S/C18H19N3OS/c1-12-7-6-9-14(13(12)2)19-17(22)11-23-18-20-15-8-4-5-10-16(15)21(18)3/h4-10H,11H2,1-3H3,(H,19,22)/p+1 |
| InChIKey | WBNMOIMIBOTPFS-UHFFFAOYSA-O |
| XLogP | 3.34 |
| TPSA | 48.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|